C10H18F3N5O — CID 105215882
2-[4-methoxy-5-(2,2,2-trifluoro-1-hydrazinylethyl)pyrazol-1-yl]-N,N-dimethylethanamine (PubChem CID 105215882) has the molecular formula C10H18F3N5O and a molecular weight of 281.28 g/mol. Its IUPAC name is 2-[4-methoxy-5-(2,2,2-trifluoro-1-hydrazinylethyl)pyrazol-1-yl]-N,N-dimethylethanamine.
| Compound Name | 2-[4-methoxy-5-(2,2,2-trifluoro-1-hydrazinylethyl)pyrazol-1-yl]-N,N-dimethylethanamine |
|---|---|
| PubChem CID | 105215882 |
| Molecular Formula | C10H18F3N5O |
| Molecular Weight | 281.28 g/mol |
| Exact Mass | 281.15 |
| IUPAC Name | 2-[4-methoxy-5-(2,2,2-trifluoro-1-hydrazinylethyl)pyrazol-1-yl]-N,N-dimethylethanamine |
| SMILES | COc1cnn(CCN(C)C)c1C(NN)C(F)(F)F |
| InChI | InChI=1S/C10H18F3N5O/c1-17(2)4-5-18-8(7(19-3)6-15-18)9(16-14)10(11,12)13/h6,9,16H,4-5,14H2,1-3H3 |
| InChIKey | HBMQOAGMJDDYMK-UHFFFAOYSA-N |
| XLogP | 0.52 |
| TPSA | 68.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.28 |
| LogP ≤ 5 | 0.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|