C16H28O8 — CID 10521669
diethyl (E,4S,5R,6S)-5,6-bis(methoxymethoxy)-4-methylhept-2-enedioate (PubChem CID 10521669) has the molecular formula C16H28O8 and a molecular weight of 348.39 g/mol. Its IUPAC name is diethyl (E,4S,5R,6S)-5,6-bis(methoxymethoxy)-4-methylhept-2-enedioate.
| Compound Name | diethyl (E,4S,5R,6S)-5,6-bis(methoxymethoxy)-4-methylhept-2-enedioate |
|---|---|
| PubChem CID | 10521669 |
| Molecular Formula | C16H28O8 |
| Molecular Weight | 348.39 g/mol |
| Exact Mass | 348.18 |
| IUPAC Name | diethyl (E,4S,5R,6S)-5,6-bis(methoxymethoxy)-4-methylhept-2-enedioate |
| SMILES | CCOC(=O)/C=C/[C@H](C)[C@@H](OCOC)[C@H](OCOC)C(=O)OCC |
| InChI | InChI=1S/C16H28O8/c1-6-21-13(17)9-8-12(3)14(23-10-19-4)15(24-11-20-5)16(18)22-7-2/h8-9,12,14-15H,6-7,10-11H2,1-5H3/b9-8+/t12-,14+,15-/m0/s1 |
| InChIKey | LEKOCPAYXARGTI-RROZTWEBSA-N |
| XLogP | 1.28 |
| TPSA | 89.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.39 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|