C19H28O4Si — CID 10521711
methyl (1R,2S,3S)-3-[tert-butyl(dimethyl)silyl]oxy-5-oxo-2-phenylcyclopentane-1-carboxylate (PubChem CID 10521711) has the molecular formula C19H28O4Si and a molecular weight of 348.51 g/mol. Its IUPAC name is methyl (1R,2S,3S)-3-[tert-butyl(dimethyl)silyl]oxy-5-oxo-2-phenylcyclopentane-1-carboxylate.
| Compound Name | methyl (1R,2S,3S)-3-[tert-butyl(dimethyl)silyl]oxy-5-oxo-2-phenylcyclopentane-1-carboxylate |
|---|---|
| PubChem CID | 10521711 |
| Molecular Formula | C19H28O4Si |
| Molecular Weight | 348.51 g/mol |
| Exact Mass | 348.18 |
| IUPAC Name | methyl (1R,2S,3S)-3-[tert-butyl(dimethyl)silyl]oxy-5-oxo-2-phenylcyclopentane-1-carboxylate |
| SMILES | COC(=O)[C@H]1C(=O)C[C@H](O[Si](C)(C)C(C)(C)C)[C@@H]1c1ccccc1 |
| InChI | InChI=1S/C19H28O4Si/c1-19(2,3)24(5,6)23-15-12-14(20)17(18(21)22-4)16(15)13-10-8-7-9-11-13/h7-11,15-17H,12H2,1-6H3/t15-,16-,17-/m0/s1 |
| InChIKey | TUZPRDDTEZMBQW-ULQDDVLXSA-N |
| XLogP | 3.92 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.51 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|