C17H19BrN2 — CID 105217124
[2-(3-bromophenyl)-1-(1-phenylcyclopropyl)ethyl]hydrazine (PubChem CID 105217124) has the molecular formula C17H19BrN2 and a molecular weight of 331.26 g/mol. Its IUPAC name is [2-(3-bromophenyl)-1-(1-phenylcyclopropyl)ethyl]hydrazine.
| Compound Name | [2-(3-bromophenyl)-1-(1-phenylcyclopropyl)ethyl]hydrazine |
|---|---|
| PubChem CID | 105217124 |
| Molecular Formula | C17H19BrN2 |
| Molecular Weight | 331.26 g/mol |
| Exact Mass | 330.07 |
| IUPAC Name | [2-(3-bromophenyl)-1-(1-phenylcyclopropyl)ethyl]hydrazine |
| SMILES | NNC(Cc1cccc(Br)c1)C1(c2ccccc2)CC1 |
| InChI | InChI=1S/C17H19BrN2/c18-15-8-4-5-13(11-15)12-16(20-19)17(9-10-17)14-6-2-1-3-7-14/h1-8,11,16,20H,9-10,12,19H2 |
| InChIKey | GTSMSEAZAODBBA-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.26 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|