C13H16N2O — CID 105218447
[1-benzofuran-2-yl(cyclobutyl)methyl]hydrazine (PubChem CID 105218447) has the molecular formula C13H16N2O and a molecular weight of 216.28 g/mol. Its IUPAC name is [1-benzofuran-2-yl(cyclobutyl)methyl]hydrazine.
| Compound Name | [1-benzofuran-2-yl(cyclobutyl)methyl]hydrazine |
|---|---|
| PubChem CID | 105218447 |
| Molecular Formula | C13H16N2O |
| Molecular Weight | 216.28 g/mol |
| Exact Mass | 216.13 |
| IUPAC Name | [1-benzofuran-2-yl(cyclobutyl)methyl]hydrazine |
| SMILES | NNC(c1cc2ccccc2o1)C1CCC1 |
| InChI | InChI=1S/C13H16N2O/c14-15-13(9-5-3-6-9)12-8-10-4-1-2-7-11(10)16-12/h1-2,4,7-9,13,15H,3,5-6,14H2 |
| InChIKey | BMKVHEGCMOWYMT-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 51.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.28 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|