C19H33NO3Si — CID 10521900
2-trimethylsilylethyl (4aS,8aR)-8a-but-3-enyl-4-oxo-3,4a,5,6,7,8-hexahydro-2H-quinoline-1-carboxylate (PubChem CID 10521900) has the molecular formula C19H33NO3Si and a molecular weight of 351.56 g/mol. Its IUPAC name is 2-trimethylsilylethyl (4aS,8aR)-8a-but-3-enyl-4-oxo-3,4a,5,6,7,8-hexahydro-2H-quinoline-1-carboxylate.
| Compound Name | 2-trimethylsilylethyl (4aS,8aR)-8a-but-3-enyl-4-oxo-3,4a,5,6,7,8-hexahydro-2H-quinoline-1-carboxylate |
|---|---|
| PubChem CID | 10521900 |
| Molecular Formula | C19H33NO3Si |
| Molecular Weight | 351.56 g/mol |
| Exact Mass | 351.22 |
| IUPAC Name | 2-trimethylsilylethyl (4aS,8aR)-8a-but-3-enyl-4-oxo-3,4a,5,6,7,8-hexahydro-2H-quinoline-1-carboxylate |
| SMILES | C=CCC[C@]12CCCC[C@@H]1C(=O)CCN2C(=O)OCC[Si](C)(C)C |
| InChI | InChI=1S/C19H33NO3Si/c1-5-6-11-19-12-8-7-9-16(19)17(21)10-13-20(19)18(22)23-14-15-24(2,3)4/h5,16H,1,6-15H2,2-4H3/t16-,19+/m1/s1 |
| InChIKey | HEFZSJWRLPUYSO-APWZRJJASA-N |
| XLogP | 4.63 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.56 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|