C7H13ClN4 — CID 105220837
(4-chloro-1-propan-2-ylpyrazol-5-yl)methylhydrazine (PubChem CID 105220837) has the molecular formula C7H13ClN4 and a molecular weight of 188.66 g/mol. Its IUPAC name is (4-chloro-1-propan-2-ylpyrazol-5-yl)methylhydrazine.
| Compound Name | (4-chloro-1-propan-2-ylpyrazol-5-yl)methylhydrazine |
|---|---|
| PubChem CID | 105220837 |
| Molecular Formula | C7H13ClN4 |
| Molecular Weight | 188.66 g/mol |
| Exact Mass | 188.08 |
| IUPAC Name | (4-chloro-1-propan-2-ylpyrazol-5-yl)methylhydrazine |
| SMILES | CC(C)n1ncc(Cl)c1CNN |
| InChI | InChI=1S/C7H13ClN4/c1-5(2)12-7(4-10-9)6(8)3-11-12/h3,5,10H,4,9H2,1-2H3 |
| InChIKey | FHKRXKSKJNTCJA-UHFFFAOYSA-N |
| XLogP | 1.08 |
| TPSA | 55.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 188.66 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|