C20H23NOS2 — CID 10522337
[(1S,3S)-1,3-diphenyl-2-oxa-6,10-dithiaspiro[4.5]decan-1-yl]methanamine (PubChem CID 10522337) has the molecular formula C20H23NOS2 and a molecular weight of 357.54 g/mol. Its IUPAC name is [(1S,3S)-1,3-diphenyl-2-oxa-6,10-dithiaspiro[4.5]decan-1-yl]methanamine.
| Compound Name | [(1S,3S)-1,3-diphenyl-2-oxa-6,10-dithiaspiro[4.5]decan-1-yl]methanamine |
|---|---|
| PubChem CID | 10522337 |
| Molecular Formula | C20H23NOS2 |
| Molecular Weight | 357.54 g/mol |
| Exact Mass | 357.12 |
| IUPAC Name | [(1S,3S)-1,3-diphenyl-2-oxa-6,10-dithiaspiro[4.5]decan-1-yl]methanamine |
| SMILES | NC[C@]1(c2ccccc2)O[C@H](c2ccccc2)CC12SCCCS2 |
| InChI | InChI=1S/C20H23NOS2/c21-15-19(17-10-5-2-6-11-17)20(23-12-7-13-24-20)14-18(22-19)16-8-3-1-4-9-16/h1-6,8-11,18H,7,12-15,21H2/t18-,19+/m0/s1 |
| InChIKey | AEVLFUBDHBVWJD-RBUKOAKNSA-N |
| XLogP | 4.57 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.54 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |