About (3-phenyl-4H-imidazo[1,5-a]quinoxalin-5-yl)-piperidin-1-ylmethanone
(3-phenyl-4H-imidazo[1,5-a]quinoxalin-5-yl)-piperidin-1-ylmethanone (PubChem CID 10522389) has the molecular formula C22H22N4O
and a molecular weight of 358.44 g/mol. Its IUPAC name is (3-phenyl-4H-imidazo[1,5-a]quinoxalin-5-yl)-piperidin-1-ylmethanone.
Molecular Properties
| Compound Name | (3-phenyl-4H-imidazo[1,5-a]quinoxalin-5-yl)-piperidin-1-ylmethanone |
| PubChem CID | 10522389 |
| Molecular Formula | C22H22N4O |
| Molecular Weight | 358.44 g/mol |
| Exact Mass | 358.18 |
| IUPAC Name | (3-phenyl-4H-imidazo[1,5-a]quinoxalin-5-yl)-piperidin-1-ylmethanone |
| SMILES | O=C(N1CCCCC1)N1Cc2c(-c3ccccc3)ncn2-c2ccccc21 |
| InChI | InChI=1S/C22H22N4O/c27-22(24-13-7-2-8-14-24)25-15-20-21(17-9-3-1-4-10-17)23-16-26(20)19-12-6-5-11-18(19)25/h1,3-6,9-12,16H,2,7-8,13-15H2 |
| InChIKey | PJEFLMXDKFQQMT-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 41.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 358.44 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (3-phenyl-4H-imidazo[1,5-a]quinoxalin-5-yl)-piperidin-1-ylmethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3-phenyl-4H-imidazo[1,5-a]quinoxalin-5-yl)-piperidin-1-ylmethanone?
The IUPAC name of (3-phenyl-4H-imidazo[1,5-a]quinoxalin-5-yl)-piperidin-1-ylmethanone (CID 10522389) is (3-phenyl-4H-imidazo[1,5-a]quinoxalin-5-yl)-piperidin-1-ylmethanone.
What is the SMILES notation for (3-phenyl-4H-imidazo[1,5-a]quinoxalin-5-yl)-piperidin-1-ylmethanone?
The canonical SMILES for (3-phenyl-4H-imidazo[1,5-a]quinoxalin-5-yl)-piperidin-1-ylmethanone is O=C(N1CCCCC1)N1Cc2c(-c3ccccc3)ncn2-c2ccccc21.
What is the InChIKey of (3-phenyl-4H-imidazo[1,5-a]quinoxalin-5-yl)-piperidin-1-ylmethanone?
The InChIKey is PJEFLMXDKFQQMT-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H22N4O/c27-22(24-13-7-2-8-14-24)25-15-20-21(17-9-3-1-4-10-17)23-16-26(20)19-12-6-5-11-18(19)25/h1,3-6,9-12,16H,2,7-8,13-15H2.
What are the key properties of (3-phenyl-4H-imidazo[1,5-a]quinoxalin-5-yl)-piperidin-1-ylmethanone?
(3-phenyl-4H-imidazo[1,5-a]quinoxalin-5-yl)-piperidin-1-ylmethanone has a molecular weight of 358.44 g/mol, XLogP of 4.47, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (3-phenyl-4H-imidazo[1,5-a]quinoxalin-5-yl)-piperidin-1-ylmethanone is sourced from PubChem (CID 10522389), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).