C19H38O4Si — CID 10522427
tert-butyl-[(2R,3R)-1-[(2S,6S)-2,6-dimethoxyoxan-4-yl]-3-methylpent-4-en-2-yl]oxy-dimethylsilane (PubChem CID 10522427) has the molecular formula C19H38O4Si and a molecular weight of 358.60 g/mol. Its IUPAC name is tert-butyl-[(2R,3R)-1-[(2S,6S)-2,6-dimethoxyoxan-4-yl]-3-methylpent-4-en-2-yl]oxy-dimethylsilane.
| Compound Name | tert-butyl-[(2R,3R)-1-[(2S,6S)-2,6-dimethoxyoxan-4-yl]-3-methylpent-4-en-2-yl]oxy-dimethylsilane |
|---|---|
| PubChem CID | 10522427 |
| Molecular Formula | C19H38O4Si |
| Molecular Weight | 358.60 g/mol |
| Exact Mass | 358.25 |
| IUPAC Name | tert-butyl-[(2R,3R)-1-[(2S,6S)-2,6-dimethoxyoxan-4-yl]-3-methylpent-4-en-2-yl]oxy-dimethylsilane |
| SMILES | C=C[C@@H](C)[C@@H](CC1C[C@@H](OC)O[C@H](OC)C1)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C19H38O4Si/c1-10-14(2)16(23-24(8,9)19(3,4)5)11-15-12-17(20-6)22-18(13-15)21-7/h10,14-18H,1,11-13H2,2-9H3/t14-,16-,17+,18+/m1/s1 |
| InChIKey | GSXQGTCGDJLZRX-BGTYHANMSA-N |
| XLogP | 4.96 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.60 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|