C18H18N2O — CID 105224637
[7-bicyclo[4.2.0]octa-1,3,5-trienyl-(7-methyl-1-benzofuran-2-yl)methyl]hydrazine (PubChem CID 105224637) has the molecular formula C18H18N2O and a molecular weight of 278.36 g/mol. Its IUPAC name is [7-bicyclo[4.2.0]octa-1,3,5-trienyl-(7-methyl-1-benzofuran-2-yl)methyl]hydrazine.
| Compound Name | [7-bicyclo[4.2.0]octa-1,3,5-trienyl-(7-methyl-1-benzofuran-2-yl)methyl]hydrazine |
|---|---|
| PubChem CID | 105224637 |
| Molecular Formula | C18H18N2O |
| Molecular Weight | 278.36 g/mol |
| Exact Mass | 278.14 |
| IUPAC Name | [7-bicyclo[4.2.0]octa-1,3,5-trienyl-(7-methyl-1-benzofuran-2-yl)methyl]hydrazine |
| SMILES | Cc1cccc2cc(C(NN)C3Cc4ccccc43)oc12 |
| InChI | InChI=1S/C18H18N2O/c1-11-5-4-7-13-10-16(21-18(11)13)17(20-19)15-9-12-6-2-3-8-14(12)15/h2-8,10,15,17,20H,9,19H2,1H3 |
| InChIKey | ABHVXBMJJPKRBQ-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 51.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.36 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|