C18H20N2O6 — CID 10522517
dimethyl (1S,3aS,4S,6aS)-1,4-bis(2-cyanoethyl)-2,5-dioxo-3,3a,6,6a-tetrahydropentalene-1,4-dicarboxylate (PubChem CID 10522517) has the molecular formula C18H20N2O6 and a molecular weight of 360.37 g/mol. Its IUPAC name is dimethyl (1S,3aS,4S,6aS)-1,4-bis(2-cyanoethyl)-2,5-dioxo-3,3a,6,6a-tetrahydropentalene-1,4-dicarboxylate.
| Compound Name | dimethyl (1S,3aS,4S,6aS)-1,4-bis(2-cyanoethyl)-2,5-dioxo-3,3a,6,6a-tetrahydropentalene-1,4-dicarboxylate |
|---|---|
| PubChem CID | 10522517 |
| Molecular Formula | C18H20N2O6 |
| Molecular Weight | 360.37 g/mol |
| Exact Mass | 360.13 |
| IUPAC Name | dimethyl (1S,3aS,4S,6aS)-1,4-bis(2-cyanoethyl)-2,5-dioxo-3,3a,6,6a-tetrahydropentalene-1,4-dicarboxylate |
| SMILES | COC(=O)[C@]1(CCC#N)C(=O)C[C@H]2[C@@H]1CC(=O)[C@@]2(CCC#N)C(=O)OC |
| InChI | InChI=1S/C18H20N2O6/c1-25-15(23)17(5-3-7-19)11-9-14(22)18(6-4-8-20,16(24)26-2)12(11)10-13(17)21/h11-12H,3-6,9-10H2,1-2H3/t11-,12-,17-,18-/m0/s1 |
| InChIKey | RKEALCLXLBFSGT-BMEPFDOTSA-N |
| XLogP | 1.09 |
| TPSA | 134.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.37 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|