C10H14F2N2S — CID 105225349
[1-(3,4-difluorophenyl)-2-ethylsulfanylethyl]hydrazine (PubChem CID 105225349) has the molecular formula C10H14F2N2S and a molecular weight of 232.30 g/mol. Its IUPAC name is [1-(3,4-difluorophenyl)-2-ethylsulfanylethyl]hydrazine.
| Compound Name | [1-(3,4-difluorophenyl)-2-ethylsulfanylethyl]hydrazine |
|---|---|
| PubChem CID | 105225349 |
| Molecular Formula | C10H14F2N2S |
| Molecular Weight | 232.30 g/mol |
| Exact Mass | 232.08 |
| IUPAC Name | [1-(3,4-difluorophenyl)-2-ethylsulfanylethyl]hydrazine |
| SMILES | CCSCC(NN)c1ccc(F)c(F)c1 |
| InChI | InChI=1S/C10H14F2N2S/c1-2-15-6-10(14-13)7-3-4-8(11)9(12)5-7/h3-5,10,14H,2,6,13H2,1H3 |
| InChIKey | IANOPOOCCLILCP-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.30 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|