C10H18N2S2 — CID 105226242
[1-(5-methylthiophen-3-yl)-2-propan-2-ylsulfanylethyl]hydrazine (PubChem CID 105226242) has the molecular formula C10H18N2S2 and a molecular weight of 230.40 g/mol. Its IUPAC name is [1-(5-methylthiophen-3-yl)-2-propan-2-ylsulfanylethyl]hydrazine.
| Compound Name | [1-(5-methylthiophen-3-yl)-2-propan-2-ylsulfanylethyl]hydrazine |
|---|---|
| PubChem CID | 105226242 |
| Molecular Formula | C10H18N2S2 |
| Molecular Weight | 230.40 g/mol |
| Exact Mass | 230.09 |
| IUPAC Name | [1-(5-methylthiophen-3-yl)-2-propan-2-ylsulfanylethyl]hydrazine |
| SMILES | Cc1cc(C(CSC(C)C)NN)cs1 |
| InChI | InChI=1S/C10H18N2S2/c1-7(2)13-6-10(12-11)9-4-8(3)14-5-9/h4-5,7,10,12H,6,11H2,1-3H3 |
| InChIKey | SSULPDNDNOCVGA-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.40 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|