About (1-tert-butylsulfanyl-5,5,5-trifluoropentan-2-yl)hydrazine
(1-tert-butylsulfanyl-5,5,5-trifluoropentan-2-yl)hydrazine (PubChem CID 105226308) has the molecular formula C9H19F3N2S
and a molecular weight of 244.33 g/mol. Its IUPAC name is (1-tert-butylsulfanyl-5,5,5-trifluoropentan-2-yl)hydrazine.
Molecular Properties
| Compound Name | (1-tert-butylsulfanyl-5,5,5-trifluoropentan-2-yl)hydrazine |
| PubChem CID | 105226308 |
| Molecular Formula | C9H19F3N2S |
| Molecular Weight | 244.33 g/mol |
| Exact Mass | 244.12 |
| IUPAC Name | (1-tert-butylsulfanyl-5,5,5-trifluoropentan-2-yl)hydrazine |
| SMILES | CC(C)(C)SCC(CCC(F)(F)F)NN |
| InChI | InChI=1S/C9H19F3N2S/c1-8(2,3)15-6-7(14-13)4-5-9(10,11)12/h7,14H,4-6,13H2,1-3H3 |
| InChIKey | BPUPLVNDCAQWKG-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 244.33 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze (1-tert-butylsulfanyl-5,5,5-trifluoropentan-2-yl)hydrazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1-tert-butylsulfanyl-5,5,5-trifluoropentan-2-yl)hydrazine?
The IUPAC name of (1-tert-butylsulfanyl-5,5,5-trifluoropentan-2-yl)hydrazine (CID 105226308) is (1-tert-butylsulfanyl-5,5,5-trifluoropentan-2-yl)hydrazine.
What is the SMILES notation for (1-tert-butylsulfanyl-5,5,5-trifluoropentan-2-yl)hydrazine?
The canonical SMILES for (1-tert-butylsulfanyl-5,5,5-trifluoropentan-2-yl)hydrazine is CC(C)(C)SCC(CCC(F)(F)F)NN.
What is the InChIKey of (1-tert-butylsulfanyl-5,5,5-trifluoropentan-2-yl)hydrazine?
The InChIKey is BPUPLVNDCAQWKG-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H19F3N2S/c1-8(2,3)15-6-7(14-13)4-5-9(10,11)12/h7,14H,4-6,13H2,1-3H3.
What are the key properties of (1-tert-butylsulfanyl-5,5,5-trifluoropentan-2-yl)hydrazine?
(1-tert-butylsulfanyl-5,5,5-trifluoropentan-2-yl)hydrazine has a molecular weight of 244.33 g/mol, XLogP of 2.69, 5 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (1-tert-butylsulfanyl-5,5,5-trifluoropentan-2-yl)hydrazine is sourced from PubChem (CID 105226308), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).