C13H24N4S — CID 105227405
[2-cyclopentylsulfanyl-1-(2-propylpyrazol-3-yl)ethyl]hydrazine (PubChem CID 105227405) has the molecular formula C13H24N4S and a molecular weight of 268.43 g/mol. Its IUPAC name is [2-cyclopentylsulfanyl-1-(2-propylpyrazol-3-yl)ethyl]hydrazine.
| Compound Name | [2-cyclopentylsulfanyl-1-(2-propylpyrazol-3-yl)ethyl]hydrazine |
|---|---|
| PubChem CID | 105227405 |
| Molecular Formula | C13H24N4S |
| Molecular Weight | 268.43 g/mol |
| Exact Mass | 268.17 |
| IUPAC Name | [2-cyclopentylsulfanyl-1-(2-propylpyrazol-3-yl)ethyl]hydrazine |
| SMILES | CCCn1nccc1C(CSC1CCCC1)NN |
| InChI | InChI=1S/C13H24N4S/c1-2-9-17-13(7-8-15-17)12(16-14)10-18-11-5-3-4-6-11/h7-8,11-12,16H,2-6,9-10,14H2,1H3 |
| InChIKey | SLYVUTOSNLITFM-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 55.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.43 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|