C10H16N6 — CID 105228414
1,2-bis(1-methylpyrazol-4-yl)ethylhydrazine (PubChem CID 105228414) has the molecular formula C10H16N6 and a molecular weight of 220.28 g/mol. Its IUPAC name is 1,2-bis(1-methylpyrazol-4-yl)ethylhydrazine.
| Compound Name | 1,2-bis(1-methylpyrazol-4-yl)ethylhydrazine |
|---|---|
| PubChem CID | 105228414 |
| Molecular Formula | C10H16N6 |
| Molecular Weight | 220.28 g/mol |
| Exact Mass | 220.14 |
| IUPAC Name | 1,2-bis(1-methylpyrazol-4-yl)ethylhydrazine |
| SMILES | Cn1cc(CC(NN)c2cnn(C)c2)cn1 |
| InChI | InChI=1S/C10H16N6/c1-15-6-8(4-12-15)3-10(14-11)9-5-13-16(2)7-9/h4-7,10,14H,3,11H2,1-2H3 |
| InChIKey | AQCIXZFQFDSBHH-UHFFFAOYSA-N |
| XLogP | -0.10 |
| TPSA | 73.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.28 |
| LogP ≤ 5 | -0.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|