C10H18N2O2 — CID 105229285
[3,4-dihydro-2H-pyran-5-yl(oxolan-3-yl)methyl]hydrazine (PubChem CID 105229285) has the molecular formula C10H18N2O2 and a molecular weight of 198.27 g/mol. Its IUPAC name is [3,4-dihydro-2H-pyran-5-yl(oxolan-3-yl)methyl]hydrazine.
| Compound Name | [3,4-dihydro-2H-pyran-5-yl(oxolan-3-yl)methyl]hydrazine |
|---|---|
| PubChem CID | 105229285 |
| Molecular Formula | C10H18N2O2 |
| Molecular Weight | 198.27 g/mol |
| Exact Mass | 198.14 |
| IUPAC Name | [3,4-dihydro-2H-pyran-5-yl(oxolan-3-yl)methyl]hydrazine |
| SMILES | NNC(C1=COCCC1)C1CCOC1 |
| InChI | InChI=1S/C10H18N2O2/c11-12-10(9-3-5-14-7-9)8-2-1-4-13-6-8/h6,9-10,12H,1-5,7,11H2 |
| InChIKey | WKRVRWMGQOOLNJ-UHFFFAOYSA-N |
| XLogP | 0.55 |
| TPSA | 56.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.27 |
| LogP ≤ 5 | 0.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|