C6H10F3N5 — CID 105230316
[4,4,4-trifluoro-1-(1H-1,2,4-triazol-5-yl)butyl]hydrazine (PubChem CID 105230316) has the molecular formula C6H10F3N5 and a molecular weight of 209.17 g/mol. Its IUPAC name is [4,4,4-trifluoro-1-(1H-1,2,4-triazol-5-yl)butyl]hydrazine.
| Compound Name | [4,4,4-trifluoro-1-(1H-1,2,4-triazol-5-yl)butyl]hydrazine |
|---|---|
| PubChem CID | 105230316 |
| Molecular Formula | C6H10F3N5 |
| Molecular Weight | 209.17 g/mol |
| Exact Mass | 209.09 |
| IUPAC Name | [4,4,4-trifluoro-1-(1H-1,2,4-triazol-5-yl)butyl]hydrazine |
| SMILES | NNC(CCC(F)(F)F)c1ncn[nH]1 |
| InChI | InChI=1S/C6H10F3N5/c7-6(8,9)2-1-4(13-10)5-11-3-12-14-5/h3-4,13H,1-2,10H2,(H,11,12,14) |
| InChIKey | FDLBUMZIHFLDLX-UHFFFAOYSA-N |
| XLogP | 0.65 |
| TPSA | 79.62 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.17 |
| LogP ≤ 5 | 0.65 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|