C14H16ClF3N2O4 — CID 10523081
3-chloro-N-(3-hydroxypropyl)-4-[[(2R)-3,3,3-trifluoro-2-hydroxy-2-methylpropanoyl]amino]benzamide (PubChem CID 10523081) has the molecular formula C14H16ClF3N2O4 and a molecular weight of 368.74 g/mol. Its IUPAC name is 3-chloro-N-(3-hydroxypropyl)-4-[[(2R)-3,3,3-trifluoro-2-hydroxy-2-methylpropanoyl]amino]benzamide.
| Compound Name | 3-chloro-N-(3-hydroxypropyl)-4-[[(2R)-3,3,3-trifluoro-2-hydroxy-2-methylpropanoyl]amino]benzamide |
|---|---|
| PubChem CID | 10523081 |
| Molecular Formula | C14H16ClF3N2O4 |
| Molecular Weight | 368.74 g/mol |
| Exact Mass | 368.08 |
| IUPAC Name | 3-chloro-N-(3-hydroxypropyl)-4-[[(2R)-3,3,3-trifluoro-2-hydroxy-2-methylpropanoyl]amino]benzamide |
| SMILES | C[C@@](O)(C(=O)Nc1ccc(C(=O)NCCCO)cc1Cl)C(F)(F)F |
| InChI | InChI=1S/C14H16ClF3N2O4/c1-13(24,14(16,17)18)12(23)20-10-4-3-8(7-9(10)15)11(22)19-5-2-6-21/h3-4,7,21,24H,2,5-6H2,1H3,(H,19,22)(H,20,23)/t13-/m1/s1 |
| InChIKey | XPOQCGFJEGWPCZ-CYBMUJFWSA-N |
| XLogP | 1.70 |
| TPSA | 98.66 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.74 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|