C14H19N7 — CID 105231084
4-[2-(1-ethylbenzimidazol-2-yl)-1-hydrazinylethyl]-1H-pyrazol-5-amine (PubChem CID 105231084) has the molecular formula C14H19N7 and a molecular weight of 285.36 g/mol. Its IUPAC name is 4-[2-(1-ethylbenzimidazol-2-yl)-1-hydrazinylethyl]-1H-pyrazol-5-amine.
| Compound Name | 4-[2-(1-ethylbenzimidazol-2-yl)-1-hydrazinylethyl]-1H-pyrazol-5-amine |
|---|---|
| PubChem CID | 105231084 |
| Molecular Formula | C14H19N7 |
| Molecular Weight | 285.36 g/mol |
| Exact Mass | 285.17 |
| IUPAC Name | 4-[2-(1-ethylbenzimidazol-2-yl)-1-hydrazinylethyl]-1H-pyrazol-5-amine |
| SMILES | CCn1c(CC(NN)c2cn[nH]c2N)nc2ccccc21 |
| InChI | InChI=1S/C14H19N7/c1-2-21-12-6-4-3-5-10(12)18-13(21)7-11(19-16)9-8-17-20-14(9)15/h3-6,8,11,19H,2,7,16H2,1H3,(H3,15,17,20) |
| InChIKey | PEQWWRIOSOGCML-UHFFFAOYSA-N |
| XLogP | 1.11 |
| TPSA | 110.57 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.36 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|