C20H38O4Si — CID 10523210
[(4S,5R,6R)-7-[tert-butyl(dimethyl)silyl]oxy-5-hydroxy-4,6-dimethylhept-2-ynyl] 2,2-dimethylpropanoate (PubChem CID 10523210) has the molecular formula C20H38O4Si and a molecular weight of 370.61 g/mol. Its IUPAC name is [(4S,5R,6R)-7-[tert-butyl(dimethyl)silyl]oxy-5-hydroxy-4,6-dimethylhept-2-ynyl] 2,2-dimethylpropanoate.
| Compound Name | [(4S,5R,6R)-7-[tert-butyl(dimethyl)silyl]oxy-5-hydroxy-4,6-dimethylhept-2-ynyl] 2,2-dimethylpropanoate |
|---|---|
| PubChem CID | 10523210 |
| Molecular Formula | C20H38O4Si |
| Molecular Weight | 370.61 g/mol |
| Exact Mass | 370.25 |
| IUPAC Name | [(4S,5R,6R)-7-[tert-butyl(dimethyl)silyl]oxy-5-hydroxy-4,6-dimethylhept-2-ynyl] 2,2-dimethylpropanoate |
| SMILES | C[C@H](CO[Si](C)(C)C(C)(C)C)[C@H](O)[C@@H](C)C#CCOC(=O)C(C)(C)C |
| InChI | InChI=1S/C20H38O4Si/c1-15(12-11-13-23-18(22)19(3,4)5)17(21)16(2)14-24-25(9,10)20(6,7)8/h15-17,21H,13-14H2,1-10H3/t15-,16+,17+/m0/s1 |
| InChIKey | XQQIRTSIWOUFQT-GVDBMIGSSA-N |
| XLogP | 4.23 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.61 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|