C16H24N2O — CID 105232138
[cycloheptyl(2,3-dihydro-1-benzofuran-7-yl)methyl]hydrazine (PubChem CID 105232138) has the molecular formula C16H24N2O and a molecular weight of 260.38 g/mol. Its IUPAC name is [cycloheptyl(2,3-dihydro-1-benzofuran-7-yl)methyl]hydrazine.
| Compound Name | [cycloheptyl(2,3-dihydro-1-benzofuran-7-yl)methyl]hydrazine |
|---|---|
| PubChem CID | 105232138 |
| Molecular Formula | C16H24N2O |
| Molecular Weight | 260.38 g/mol |
| Exact Mass | 260.19 |
| IUPAC Name | [cycloheptyl(2,3-dihydro-1-benzofuran-7-yl)methyl]hydrazine |
| SMILES | NNC(c1cccc2c1OCC2)C1CCCCCC1 |
| InChI | InChI=1S/C16H24N2O/c17-18-15(12-6-3-1-2-4-7-12)14-9-5-8-13-10-11-19-16(13)14/h5,8-9,12,15,18H,1-4,6-7,10-11,17H2 |
| InChIKey | UDTMDUAOMKGZGW-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 47.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.38 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|