C16H25N3O5S — CID 10523264
O-[(1R,2R,7S,8aR)-1,2-bis(methoxymethoxy)-1,2,3,5,6,7,8,8a-octahydroindolizin-7-yl] imidazole-1-carbothioate (PubChem CID 10523264) has the molecular formula C16H25N3O5S and a molecular weight of 371.46 g/mol. Its IUPAC name is O-[(1R,2R,7S,8aR)-1,2-bis(methoxymethoxy)-1,2,3,5,6,7,8,8a-octahydroindolizin-7-yl] imidazole-1-carbothioate.
| Compound Name | O-[(1R,2R,7S,8aR)-1,2-bis(methoxymethoxy)-1,2,3,5,6,7,8,8a-octahydroindolizin-7-yl] imidazole-1-carbothioate |
|---|---|
| PubChem CID | 10523264 |
| Molecular Formula | C16H25N3O5S |
| Molecular Weight | 371.46 g/mol |
| Exact Mass | 371.15 |
| IUPAC Name | O-[(1R,2R,7S,8aR)-1,2-bis(methoxymethoxy)-1,2,3,5,6,7,8,8a-octahydroindolizin-7-yl] imidazole-1-carbothioate |
| SMILES | COCO[C@@H]1[C@H]2C[C@@H](OC(=S)n3ccnc3)CCN2C[C@H]1OCOC |
| InChI | InChI=1S/C16H25N3O5S/c1-20-10-22-14-8-18-5-3-12(7-13(18)15(14)23-11-21-2)24-16(25)19-6-4-17-9-19/h4,6,9,12-15H,3,5,7-8,10-11H2,1-2H3/t12-,13+,14+,15+/m0/s1 |
| InChIKey | IXWQQWRXHKYDKX-GBJTYRQASA-N |
| XLogP | 0.86 |
| TPSA | 67.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.46 |
| LogP ≤ 5 | 0.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|