C22H29NO4 — CID 10523269
(4S)-4-benzyl-3-[2-[(2S,3S,4R,6S)-3,4-dimethyl-6-prop-2-enyloxan-2-yl]acetyl]-1,3-oxazolidin-2-one (PubChem CID 10523269) has the molecular formula C22H29NO4 and a molecular weight of 371.48 g/mol. Its IUPAC name is (4S)-4-benzyl-3-[2-[(2S,3S,4R,6S)-3,4-dimethyl-6-prop-2-enyloxan-2-yl]acetyl]-1,3-oxazolidin-2-one.
| Compound Name | (4S)-4-benzyl-3-[2-[(2S,3S,4R,6S)-3,4-dimethyl-6-prop-2-enyloxan-2-yl]acetyl]-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 10523269 |
| Molecular Formula | C22H29NO4 |
| Molecular Weight | 371.48 g/mol |
| Exact Mass | 371.21 |
| IUPAC Name | (4S)-4-benzyl-3-[2-[(2S,3S,4R,6S)-3,4-dimethyl-6-prop-2-enyloxan-2-yl]acetyl]-1,3-oxazolidin-2-one |
| SMILES | C=CC[C@H]1C[C@@H](C)[C@H](C)[C@H](CC(=O)N2C(=O)OC[C@@H]2Cc2ccccc2)O1 |
| InChI | InChI=1S/C22H29NO4/c1-4-8-19-11-15(2)16(3)20(27-19)13-21(24)23-18(14-26-22(23)25)12-17-9-6-5-7-10-17/h4-7,9-10,15-16,18-20H,1,8,11-14H2,2-3H3/t15-,16+,18+,19+,20+/m1/s1 |
| InChIKey | YXMBJCLRYVFTHR-JVJLKXRTSA-N |
| XLogP | 3.97 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.48 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|