C17H25BrN2O — CID 105233707
[2-(5-bromo-2,3-dihydro-1-benzofuran-7-yl)-1-(3-ethylcyclopentyl)ethyl]hydrazine (PubChem CID 105233707) has the molecular formula C17H25BrN2O and a molecular weight of 353.30 g/mol. Its IUPAC name is [2-(5-bromo-2,3-dihydro-1-benzofuran-7-yl)-1-(3-ethylcyclopentyl)ethyl]hydrazine.
| Compound Name | [2-(5-bromo-2,3-dihydro-1-benzofuran-7-yl)-1-(3-ethylcyclopentyl)ethyl]hydrazine |
|---|---|
| PubChem CID | 105233707 |
| Molecular Formula | C17H25BrN2O |
| Molecular Weight | 353.30 g/mol |
| Exact Mass | 352.12 |
| IUPAC Name | [2-(5-bromo-2,3-dihydro-1-benzofuran-7-yl)-1-(3-ethylcyclopentyl)ethyl]hydrazine |
| SMILES | CCC1CCC(C(Cc2cc(Br)cc3c2OCC3)NN)C1 |
| InChI | InChI=1S/C17H25BrN2O/c1-2-11-3-4-12(7-11)16(20-19)10-14-9-15(18)8-13-5-6-21-17(13)14/h8-9,11-12,16,20H,2-7,10,19H2,1H3 |
| InChIKey | CBSIZGJIHVIDIW-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 47.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.30 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|