C17H19FN2O — CID 105233881
[3,4-dihydro-2H-chromen-4-yl-(3-fluoro-5-methylphenyl)methyl]hydrazine (PubChem CID 105233881) has the molecular formula C17H19FN2O and a molecular weight of 286.35 g/mol. Its IUPAC name is [3,4-dihydro-2H-chromen-4-yl-(3-fluoro-5-methylphenyl)methyl]hydrazine.
| Compound Name | [3,4-dihydro-2H-chromen-4-yl-(3-fluoro-5-methylphenyl)methyl]hydrazine |
|---|---|
| PubChem CID | 105233881 |
| Molecular Formula | C17H19FN2O |
| Molecular Weight | 286.35 g/mol |
| Exact Mass | 286.15 |
| IUPAC Name | [3,4-dihydro-2H-chromen-4-yl-(3-fluoro-5-methylphenyl)methyl]hydrazine |
| SMILES | Cc1cc(F)cc(C(NN)C2CCOc3ccccc32)c1 |
| InChI | InChI=1S/C17H19FN2O/c1-11-8-12(10-13(18)9-11)17(20-19)15-6-7-21-16-5-3-2-4-14(15)16/h2-5,8-10,15,17,20H,6-7,19H2,1H3 |
| InChIKey | QKZXETDRVZRANS-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 47.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.35 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|