C15H20N2O2 — CID 105233911
[3,4-dihydro-2H-chromen-3-yl(3,4-dihydro-2H-pyran-5-yl)methyl]hydrazine (PubChem CID 105233911) has the molecular formula C15H20N2O2 and a molecular weight of 260.34 g/mol. Its IUPAC name is [3,4-dihydro-2H-chromen-3-yl(3,4-dihydro-2H-pyran-5-yl)methyl]hydrazine.
| Compound Name | [3,4-dihydro-2H-chromen-3-yl(3,4-dihydro-2H-pyran-5-yl)methyl]hydrazine |
|---|---|
| PubChem CID | 105233911 |
| Molecular Formula | C15H20N2O2 |
| Molecular Weight | 260.34 g/mol |
| Exact Mass | 260.15 |
| IUPAC Name | [3,4-dihydro-2H-chromen-3-yl(3,4-dihydro-2H-pyran-5-yl)methyl]hydrazine |
| SMILES | NNC(C1=COCCC1)C1COc2ccccc2C1 |
| InChI | InChI=1S/C15H20N2O2/c16-17-15(12-5-3-7-18-9-12)13-8-11-4-1-2-6-14(11)19-10-13/h1-2,4,6,9,13,15,17H,3,5,7-8,10,16H2 |
| InChIKey | IWAYTCKXTFVICF-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 56.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.34 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|