C12H19ClN2 — CID 105235498
[4-chloro-1-(3-ethylphenyl)butyl]hydrazine (PubChem CID 105235498) has the molecular formula C12H19ClN2 and a molecular weight of 226.75 g/mol. Its IUPAC name is [4-chloro-1-(3-ethylphenyl)butyl]hydrazine.
| Compound Name | [4-chloro-1-(3-ethylphenyl)butyl]hydrazine |
|---|---|
| PubChem CID | 105235498 |
| Molecular Formula | C12H19ClN2 |
| Molecular Weight | 226.75 g/mol |
| Exact Mass | 226.12 |
| IUPAC Name | [4-chloro-1-(3-ethylphenyl)butyl]hydrazine |
| SMILES | CCc1cccc(C(CCCCl)NN)c1 |
| InChI | InChI=1S/C12H19ClN2/c1-2-10-5-3-6-11(9-10)12(15-14)7-4-8-13/h3,5-6,9,12,15H,2,4,7-8,14H2,1H3 |
| InChIKey | JMSHSZHPDQPOSZ-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.75 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|