About (8-cyclopentyl-2,6-dioxo-1-propyl-3H-purin-7-yl)methyl 2,2-dimethylpropanoate
(8-cyclopentyl-2,6-dioxo-1-propyl-3H-purin-7-yl)methyl 2,2-dimethylpropanoate (PubChem CID 10523576) has the molecular formula C19H28N4O4
and a molecular weight of 376.46 g/mol. Its IUPAC name is (8-cyclopentyl-2,6-dioxo-1-propyl-3H-purin-7-yl)methyl 2,2-dimethylpropanoate.
Molecular Properties
| Compound Name | (8-cyclopentyl-2,6-dioxo-1-propyl-3H-purin-7-yl)methyl 2,2-dimethylpropanoate |
| PubChem CID | 10523576 |
| Molecular Formula | C19H28N4O4 |
| Molecular Weight | 376.46 g/mol |
| Exact Mass | 376.21 |
| IUPAC Name | (8-cyclopentyl-2,6-dioxo-1-propyl-3H-purin-7-yl)methyl 2,2-dimethylpropanoate |
| SMILES | CCCn1c(=O)[nH]c2nc(C3CCCC3)n(COC(=O)C(C)(C)C)c2c1=O |
| InChI | InChI=1S/C19H28N4O4/c1-5-10-22-16(24)13-14(21-18(22)26)20-15(12-8-6-7-9-12)23(13)11-27-17(25)19(2,3)4/h12H,5-11H2,1-4H3,(H,21,26) |
| InChIKey | UOOSNTOSOBTPDR-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 98.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 376.46 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze (8-cyclopentyl-2,6-dioxo-1-propyl-3H-purin-7-yl)methyl 2,2-dimethylpropanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (8-cyclopentyl-2,6-dioxo-1-propyl-3H-purin-7-yl)methyl 2,2-dimethylpropanoate?
The IUPAC name of (8-cyclopentyl-2,6-dioxo-1-propyl-3H-purin-7-yl)methyl 2,2-dimethylpropanoate (CID 10523576) is (8-cyclopentyl-2,6-dioxo-1-propyl-3H-purin-7-yl)methyl 2,2-dimethylpropanoate.
What is the SMILES notation for (8-cyclopentyl-2,6-dioxo-1-propyl-3H-purin-7-yl)methyl 2,2-dimethylpropanoate?
The canonical SMILES for (8-cyclopentyl-2,6-dioxo-1-propyl-3H-purin-7-yl)methyl 2,2-dimethylpropanoate is CCCn1c(=O)[nH]c2nc(C3CCCC3)n(COC(=O)C(C)(C)C)c2c1=O.
What is the InChIKey of (8-cyclopentyl-2,6-dioxo-1-propyl-3H-purin-7-yl)methyl 2,2-dimethylpropanoate?
The InChIKey is UOOSNTOSOBTPDR-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H28N4O4/c1-5-10-22-16(24)13-14(21-18(22)26)20-15(12-8-6-7-9-12)23(13)11-27-17(25)19(2,3)4/h12H,5-11H2,1-4H3,(H,21,26).
What are the key properties of (8-cyclopentyl-2,6-dioxo-1-propyl-3H-purin-7-yl)methyl 2,2-dimethylpropanoate?
(8-cyclopentyl-2,6-dioxo-1-propyl-3H-purin-7-yl)methyl 2,2-dimethylpropanoate has a molecular weight of 376.46 g/mol, XLogP of 2.50, 5 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for (8-cyclopentyl-2,6-dioxo-1-propyl-3H-purin-7-yl)methyl 2,2-dimethylpropanoate is sourced from PubChem (CID 10523576), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).