C18H36O6Si — CID 10523606
[(2R,3S)-2-[tert-butyl(dimethyl)silyl]oxy-3-(methoxymethoxy)-5-oxopentyl] 2,2-dimethylpropanoate (PubChem CID 10523606) has the molecular formula C18H36O6Si and a molecular weight of 376.57 g/mol. Its IUPAC name is [(2R,3S)-2-[tert-butyl(dimethyl)silyl]oxy-3-(methoxymethoxy)-5-oxopentyl] 2,2-dimethylpropanoate.
| Compound Name | [(2R,3S)-2-[tert-butyl(dimethyl)silyl]oxy-3-(methoxymethoxy)-5-oxopentyl] 2,2-dimethylpropanoate |
|---|---|
| PubChem CID | 10523606 |
| Molecular Formula | C18H36O6Si |
| Molecular Weight | 376.57 g/mol |
| Exact Mass | 376.23 |
| IUPAC Name | [(2R,3S)-2-[tert-butyl(dimethyl)silyl]oxy-3-(methoxymethoxy)-5-oxopentyl] 2,2-dimethylpropanoate |
| SMILES | COCO[C@@H](CC=O)[C@@H](COC(=O)C(C)(C)C)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C18H36O6Si/c1-17(2,3)16(20)22-12-15(14(10-11-19)23-13-21-7)24-25(8,9)18(4,5)6/h11,14-15H,10,12-13H2,1-9H3/t14-,15+/m0/s1 |
| InChIKey | IAQDORDTCXOAQH-LSDHHAIUSA-N |
| XLogP | 3.54 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.57 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|