C19H30Cl2O3 — CID 10523628
(4R,5R,7S,8S,11R)-4-(2,2-dichloroethyl)-11-methyl-8-propan-2-yl-6,13-dioxadispiro[4.1.57.35]pentadecan-14-one (PubChem CID 10523628) has the molecular formula C19H30Cl2O3 and a molecular weight of 377.35 g/mol. Its IUPAC name is (4R,5R,7S,8S,11R)-4-(2,2-dichloroethyl)-11-methyl-8-propan-2-yl-6,13-dioxadispiro[4.1.57.35]pentadecan-14-one.
| Compound Name | (4R,5R,7S,8S,11R)-4-(2,2-dichloroethyl)-11-methyl-8-propan-2-yl-6,13-dioxadispiro[4.1.57.35]pentadecan-14-one |
|---|---|
| PubChem CID | 10523628 |
| Molecular Formula | C19H30Cl2O3 |
| Molecular Weight | 377.35 g/mol |
| Exact Mass | 376.16 |
| IUPAC Name | (4R,5R,7S,8S,11R)-4-(2,2-dichloroethyl)-11-methyl-8-propan-2-yl-6,13-dioxadispiro[4.1.57.35]pentadecan-14-one |
| SMILES | CC(C)[C@@H]1CC[C@@H](C)C[C@]12OC(=O)C[C@@]1(CCC[C@@H]1CC(Cl)Cl)O2 |
| InChI | InChI=1S/C19H30Cl2O3/c1-12(2)15-7-6-13(3)10-19(15)23-17(22)11-18(24-19)8-4-5-14(18)9-16(20)21/h12-16H,4-11H2,1-3H3/t13-,14-,15+,18-,19-/m1/s1 |
| InChIKey | PXRQLXQEOYNZJK-QGRWZNMESA-N |
| XLogP | 5.47 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.35 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|