C20H27NO6 — CID 10523635
[[(1R)-1-[(3aS,4S,6R,6aS)-4-methoxy-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]prop-2-enyl]-benzylamino] acetate (PubChem CID 10523635) has the molecular formula C20H27NO6 and a molecular weight of 377.44 g/mol. Its IUPAC name is [[(1R)-1-[(3aS,4S,6R,6aS)-4-methoxy-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]prop-2-enyl]-benzylamino] acetate.
| Compound Name | [[(1R)-1-[(3aS,4S,6R,6aS)-4-methoxy-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]prop-2-enyl]-benzylamino] acetate |
|---|---|
| PubChem CID | 10523635 |
| Molecular Formula | C20H27NO6 |
| Molecular Weight | 377.44 g/mol |
| Exact Mass | 377.18 |
| IUPAC Name | [[(1R)-1-[(3aS,4S,6R,6aS)-4-methoxy-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]prop-2-enyl]-benzylamino] acetate |
| SMILES | C=C[C@H]([C@H]1O[C@H](OC)[C@H]2OC(C)(C)O[C@H]21)N(Cc1ccccc1)OC(C)=O |
| InChI | InChI=1S/C20H27NO6/c1-6-15(21(27-13(2)22)12-14-10-8-7-9-11-14)16-17-18(19(23-5)24-16)26-20(3,4)25-17/h6-11,15-19H,1,12H2,2-5H3/t15-,16-,17+,18+,19+/m1/s1 |
| InChIKey | UQQJYPDFXPIOSL-GFEQUFNTSA-N |
| XLogP | 2.41 |
| TPSA | 66.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.44 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|