C12H13FN4S — CID 105236619
[2-(4-fluorophenyl)sulfanyl-1-pyrimidin-5-ylethyl]hydrazine (PubChem CID 105236619) has the molecular formula C12H13FN4S and a molecular weight of 264.33 g/mol. Its IUPAC name is [2-(4-fluorophenyl)sulfanyl-1-pyrimidin-5-ylethyl]hydrazine.
| Compound Name | [2-(4-fluorophenyl)sulfanyl-1-pyrimidin-5-ylethyl]hydrazine |
|---|---|
| PubChem CID | 105236619 |
| Molecular Formula | C12H13FN4S |
| Molecular Weight | 264.33 g/mol |
| Exact Mass | 264.08 |
| IUPAC Name | [2-(4-fluorophenyl)sulfanyl-1-pyrimidin-5-ylethyl]hydrazine |
| SMILES | NNC(CSc1ccc(F)cc1)c1cncnc1 |
| InChI | InChI=1S/C12H13FN4S/c13-10-1-3-11(4-2-10)18-7-12(17-14)9-5-15-8-16-6-9/h1-6,8,12,17H,7,14H2 |
| InChIKey | JVQQKKJRWVPUFC-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 63.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.33 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|