C24H30O2Si — CID 10523724
(3aR,6aS)-5-[tert-butyl(diphenyl)silyl]oxy-3,3a,4,5,6,6a-hexahydro-1H-pentalen-2-one (PubChem CID 10523724) has the molecular formula C24H30O2Si and a molecular weight of 378.59 g/mol. Its IUPAC name is (3aR,6aS)-5-[tert-butyl(diphenyl)silyl]oxy-3,3a,4,5,6,6a-hexahydro-1H-pentalen-2-one.
| Compound Name | (3aR,6aS)-5-[tert-butyl(diphenyl)silyl]oxy-3,3a,4,5,6,6a-hexahydro-1H-pentalen-2-one |
|---|---|
| PubChem CID | 10523724 |
| Molecular Formula | C24H30O2Si |
| Molecular Weight | 378.59 g/mol |
| Exact Mass | 378.20 |
| IUPAC Name | (3aR,6aS)-5-[tert-butyl(diphenyl)silyl]oxy-3,3a,4,5,6,6a-hexahydro-1H-pentalen-2-one |
| SMILES | CC(C)(C)[Si](OC1C[C@H]2CC(=O)C[C@H]2C1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C24H30O2Si/c1-24(2,3)27(22-10-6-4-7-11-22,23-12-8-5-9-13-23)26-21-16-18-14-20(25)15-19(18)17-21/h4-13,18-19,21H,14-17H2,1-3H3/t18-,19+,21? |
| InChIKey | VXWHJZKIBZBRHJ-PMSBKCLSSA-N |
| XLogP | 4.32 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.59 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|