C13H15BrN2OS — CID 105238115
[1-(2-bromophenyl)sulfanyl-3-(furan-3-yl)propan-2-yl]hydrazine (PubChem CID 105238115) has the molecular formula C13H15BrN2OS and a molecular weight of 327.25 g/mol. Its IUPAC name is [1-(2-bromophenyl)sulfanyl-3-(furan-3-yl)propan-2-yl]hydrazine.
| Compound Name | [1-(2-bromophenyl)sulfanyl-3-(furan-3-yl)propan-2-yl]hydrazine |
|---|---|
| PubChem CID | 105238115 |
| Molecular Formula | C13H15BrN2OS |
| Molecular Weight | 327.25 g/mol |
| Exact Mass | 326.01 |
| IUPAC Name | [1-(2-bromophenyl)sulfanyl-3-(furan-3-yl)propan-2-yl]hydrazine |
| SMILES | NNC(CSc1ccccc1Br)Cc1ccoc1 |
| InChI | InChI=1S/C13H15BrN2OS/c14-12-3-1-2-4-13(12)18-9-11(16-15)7-10-5-6-17-8-10/h1-6,8,11,16H,7,9,15H2 |
| InChIKey | IGXKUQUVLRGUEQ-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 51.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.25 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|