About (5,7-dihydroxy-2,2-dimethylchromen-8-yl)-[3-hydroxy-2-(3-methylbut-2-enyl)phenyl]methanone
(5,7-dihydroxy-2,2-dimethylchromen-8-yl)-[3-hydroxy-2-(3-methylbut-2-enyl)phenyl]methanone (PubChem CID 10523817) has the molecular formula C23H24O5
and a molecular weight of 380.44 g/mol. Its IUPAC name is (5,7-dihydroxy-2,2-dimethylchromen-8-yl)-[3-hydroxy-2-(3-methylbut-2-enyl)phenyl]methanone.
Molecular Properties
| Compound Name | (5,7-dihydroxy-2,2-dimethylchromen-8-yl)-[3-hydroxy-2-(3-methylbut-2-enyl)phenyl]methanone |
| PubChem CID | 10523817 |
| Molecular Formula | C23H24O5 |
| Molecular Weight | 380.44 g/mol |
| Exact Mass | 380.16 |
| IUPAC Name | (5,7-dihydroxy-2,2-dimethylchromen-8-yl)-[3-hydroxy-2-(3-methylbut-2-enyl)phenyl]methanone |
| SMILES | CC(C)=CCc1c(O)cccc1C(=O)c1c(O)cc(O)c2c1OC(C)(C)C=C2 |
| InChI | InChI=1S/C23H24O5/c1-13(2)8-9-14-15(6-5-7-17(14)24)21(27)20-19(26)12-18(25)16-10-11-23(3,4)28-22(16)20/h5-8,10-12,24-26H,9H2,1-4H3 |
| InChIKey | SUXKBSUPVSIJAI-UHFFFAOYSA-N |
| XLogP | 4.73 |
| TPSA | 86.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 380.44 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (5,7-dihydroxy-2,2-dimethylchromen-8-yl)-[3-hydroxy-2-(3-methylbut-2-enyl)phenyl]methanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (5,7-dihydroxy-2,2-dimethylchromen-8-yl)-[3-hydroxy-2-(3-methylbut-2-enyl)phenyl]methanone?
The IUPAC name of (5,7-dihydroxy-2,2-dimethylchromen-8-yl)-[3-hydroxy-2-(3-methylbut-2-enyl)phenyl]methanone (CID 10523817) is (5,7-dihydroxy-2,2-dimethylchromen-8-yl)-[3-hydroxy-2-(3-methylbut-2-enyl)phenyl]methanone.
What is the SMILES notation for (5,7-dihydroxy-2,2-dimethylchromen-8-yl)-[3-hydroxy-2-(3-methylbut-2-enyl)phenyl]methanone?
The canonical SMILES for (5,7-dihydroxy-2,2-dimethylchromen-8-yl)-[3-hydroxy-2-(3-methylbut-2-enyl)phenyl]methanone is CC(C)=CCc1c(O)cccc1C(=O)c1c(O)cc(O)c2c1OC(C)(C)C=C2.
What is the InChIKey of (5,7-dihydroxy-2,2-dimethylchromen-8-yl)-[3-hydroxy-2-(3-methylbut-2-enyl)phenyl]methanone?
The InChIKey is SUXKBSUPVSIJAI-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H24O5/c1-13(2)8-9-14-15(6-5-7-17(14)24)21(27)20-19(26)12-18(25)16-10-11-23(3,4)28-22(16)20/h5-8,10-12,24-26H,9H2,1-4H3.
What are the key properties of (5,7-dihydroxy-2,2-dimethylchromen-8-yl)-[3-hydroxy-2-(3-methylbut-2-enyl)phenyl]methanone?
(5,7-dihydroxy-2,2-dimethylchromen-8-yl)-[3-hydroxy-2-(3-methylbut-2-enyl)phenyl]methanone has a molecular weight of 380.44 g/mol, XLogP of 4.73, 4 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (5,7-dihydroxy-2,2-dimethylchromen-8-yl)-[3-hydroxy-2-(3-methylbut-2-enyl)phenyl]methanone is sourced from PubChem (CID 10523817), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).