C14H15BrClN3S — CID 105238384
[1-(3-bromophenyl)sulfanyl-3-(3-chloro-4-pyridinyl)propan-2-yl]hydrazine (PubChem CID 105238384) has the molecular formula C14H15BrClN3S and a molecular weight of 372.72 g/mol. Its IUPAC name is [1-(3-bromophenyl)sulfanyl-3-(3-chloro-4-pyridinyl)propan-2-yl]hydrazine.
| Compound Name | [1-(3-bromophenyl)sulfanyl-3-(3-chloro-4-pyridinyl)propan-2-yl]hydrazine |
|---|---|
| PubChem CID | 105238384 |
| Molecular Formula | C14H15BrClN3S |
| Molecular Weight | 372.72 g/mol |
| Exact Mass | 370.99 |
| IUPAC Name | [1-(3-bromophenyl)sulfanyl-3-(3-chloro-4-pyridinyl)propan-2-yl]hydrazine |
| SMILES | NNC(CSc1cccc(Br)c1)Cc1ccncc1Cl |
| InChI | InChI=1S/C14H15BrClN3S/c15-11-2-1-3-13(7-11)20-9-12(19-17)6-10-4-5-18-8-14(10)16/h1-5,7-8,12,19H,6,9,17H2 |
| InChIKey | FTBQNVMJZGLNOT-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.72 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|