C16H16BrFN2 — CID 105238729
[2-(7-bicyclo[4.2.0]octa-1,3,5-trienyl)-1-(3-bromo-5-fluorophenyl)ethyl]hydrazine (PubChem CID 105238729) has the molecular formula C16H16BrFN2 and a molecular weight of 335.22 g/mol. Its IUPAC name is [2-(7-bicyclo[4.2.0]octa-1,3,5-trienyl)-1-(3-bromo-5-fluorophenyl)ethyl]hydrazine.
| Compound Name | [2-(7-bicyclo[4.2.0]octa-1,3,5-trienyl)-1-(3-bromo-5-fluorophenyl)ethyl]hydrazine |
|---|---|
| PubChem CID | 105238729 |
| Molecular Formula | C16H16BrFN2 |
| Molecular Weight | 335.22 g/mol |
| Exact Mass | 334.05 |
| IUPAC Name | [2-(7-bicyclo[4.2.0]octa-1,3,5-trienyl)-1-(3-bromo-5-fluorophenyl)ethyl]hydrazine |
| SMILES | NNC(CC1Cc2ccccc21)c1cc(F)cc(Br)c1 |
| InChI | InChI=1S/C16H16BrFN2/c17-13-6-12(7-14(18)9-13)16(20-19)8-11-5-10-3-1-2-4-15(10)11/h1-4,6-7,9,11,16,20H,5,8,19H2 |
| InChIKey | MCFPDIPNOWNLSQ-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.22 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|