C9H20F3N3 — CID 105238816
6,6,6-trifluoro-3-hydrazinyl-N,N,2-trimethylhexan-2-amine (PubChem CID 105238816) has the molecular formula C9H20F3N3 and a molecular weight of 227.27 g/mol. Its IUPAC name is 6,6,6-trifluoro-3-hydrazinyl-N,N,2-trimethylhexan-2-amine.
| Compound Name | 6,6,6-trifluoro-3-hydrazinyl-N,N,2-trimethylhexan-2-amine |
|---|---|
| PubChem CID | 105238816 |
| Molecular Formula | C9H20F3N3 |
| Molecular Weight | 227.27 g/mol |
| Exact Mass | 227.16 |
| IUPAC Name | 6,6,6-trifluoro-3-hydrazinyl-N,N,2-trimethylhexan-2-amine |
| SMILES | CN(C)C(C)(C)C(CCC(F)(F)F)NN |
| InChI | InChI=1S/C9H20F3N3/c1-8(2,15(3)4)7(14-13)5-6-9(10,11)12/h7,14H,5-6,13H2,1-4H3 |
| InChIKey | XRKHUFYMWPRSQL-UHFFFAOYSA-N |
| XLogP | 1.50 |
| TPSA | 41.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.27 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|