C12H27N3O — CID 105238872
3-hydrazinyl-N,N,2-trimethyl-4-(oxan-4-yl)butan-2-amine (PubChem CID 105238872) has the molecular formula C12H27N3O and a molecular weight of 229.37 g/mol. Its IUPAC name is 3-hydrazinyl-N,N,2-trimethyl-4-(oxan-4-yl)butan-2-amine.
| Compound Name | 3-hydrazinyl-N,N,2-trimethyl-4-(oxan-4-yl)butan-2-amine |
|---|---|
| PubChem CID | 105238872 |
| Molecular Formula | C12H27N3O |
| Molecular Weight | 229.37 g/mol |
| Exact Mass | 229.22 |
| IUPAC Name | 3-hydrazinyl-N,N,2-trimethyl-4-(oxan-4-yl)butan-2-amine |
| SMILES | CN(C)C(C)(C)C(CC1CCOCC1)NN |
| InChI | InChI=1S/C12H27N3O/c1-12(2,15(3)4)11(14-13)9-10-5-7-16-8-6-10/h10-11,14H,5-9,13H2,1-4H3 |
| InChIKey | RKYFSCDNUPWNRM-UHFFFAOYSA-N |
| XLogP | 0.98 |
| TPSA | 50.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.37 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|