C10H22F3N3 — CID 105238929
7,7,7-trifluoro-3-hydrazinyl-N,N,2-trimethylheptan-2-amine (PubChem CID 105238929) has the molecular formula C10H22F3N3 and a molecular weight of 241.30 g/mol. Its IUPAC name is 7,7,7-trifluoro-3-hydrazinyl-N,N,2-trimethylheptan-2-amine.
| Compound Name | 7,7,7-trifluoro-3-hydrazinyl-N,N,2-trimethylheptan-2-amine |
|---|---|
| PubChem CID | 105238929 |
| Molecular Formula | C10H22F3N3 |
| Molecular Weight | 241.30 g/mol |
| Exact Mass | 241.18 |
| IUPAC Name | 7,7,7-trifluoro-3-hydrazinyl-N,N,2-trimethylheptan-2-amine |
| SMILES | CN(C)C(C)(C)C(CCCC(F)(F)F)NN |
| InChI | InChI=1S/C10H22F3N3/c1-9(2,16(3)4)8(15-14)6-5-7-10(11,12)13/h8,15H,5-7,14H2,1-4H3 |
| InChIKey | AKZVQIHNUYOUJC-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 41.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.30 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|