C11H24F3N3 — CID 105239166
N,N-diethyl-6,6,6-trifluoro-3-hydrazinyl-2-methylhexan-2-amine (PubChem CID 105239166) has the molecular formula C11H24F3N3 and a molecular weight of 255.33 g/mol. Its IUPAC name is N,N-diethyl-6,6,6-trifluoro-3-hydrazinyl-2-methylhexan-2-amine.
| Compound Name | N,N-diethyl-6,6,6-trifluoro-3-hydrazinyl-2-methylhexan-2-amine |
|---|---|
| PubChem CID | 105239166 |
| Molecular Formula | C11H24F3N3 |
| Molecular Weight | 255.33 g/mol |
| Exact Mass | 255.19 |
| IUPAC Name | N,N-diethyl-6,6,6-trifluoro-3-hydrazinyl-2-methylhexan-2-amine |
| SMILES | CCN(CC)C(C)(C)C(CCC(F)(F)F)NN |
| InChI | InChI=1S/C11H24F3N3/c1-5-17(6-2)10(3,4)9(16-15)7-8-11(12,13)14/h9,16H,5-8,15H2,1-4H3 |
| InChIKey | YAXLOZWXXLRAJH-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 41.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.33 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|