C12H26F3N3 — CID 105239263
N,N-diethyl-7,7,7-trifluoro-3-hydrazinyl-2-methylheptan-2-amine (PubChem CID 105239263) has the molecular formula C12H26F3N3 and a molecular weight of 269.35 g/mol. Its IUPAC name is N,N-diethyl-7,7,7-trifluoro-3-hydrazinyl-2-methylheptan-2-amine.
| Compound Name | N,N-diethyl-7,7,7-trifluoro-3-hydrazinyl-2-methylheptan-2-amine |
|---|---|
| PubChem CID | 105239263 |
| Molecular Formula | C12H26F3N3 |
| Molecular Weight | 269.35 g/mol |
| Exact Mass | 269.21 |
| IUPAC Name | N,N-diethyl-7,7,7-trifluoro-3-hydrazinyl-2-methylheptan-2-amine |
| SMILES | CCN(CC)C(C)(C)C(CCCC(F)(F)F)NN |
| InChI | InChI=1S/C12H26F3N3/c1-5-18(6-2)11(3,4)10(17-16)8-7-9-12(13,14)15/h10,17H,5-9,16H2,1-4H3 |
| InChIKey | QYHKEFDSSHPENU-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 41.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.35 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|