C18H20F6O2 — CID 10523946
(1E,4Z)-5-ethoxy-6,6,6-trifluoro-3-(trifluoromethyl)-1-(2,4,6-trimethylphenyl)hexa-1,4-dien-3-ol (PubChem CID 10523946) has the molecular formula C18H20F6O2 and a molecular weight of 382.34 g/mol. Its IUPAC name is (1E,4Z)-5-ethoxy-6,6,6-trifluoro-3-(trifluoromethyl)-1-(2,4,6-trimethylphenyl)hexa-1,4-dien-3-ol.
| Compound Name | (1E,4Z)-5-ethoxy-6,6,6-trifluoro-3-(trifluoromethyl)-1-(2,4,6-trimethylphenyl)hexa-1,4-dien-3-ol |
|---|---|
| PubChem CID | 10523946 |
| Molecular Formula | C18H20F6O2 |
| Molecular Weight | 382.34 g/mol |
| Exact Mass | 382.14 |
| IUPAC Name | (1E,4Z)-5-ethoxy-6,6,6-trifluoro-3-(trifluoromethyl)-1-(2,4,6-trimethylphenyl)hexa-1,4-dien-3-ol |
| SMILES | CCO/C(=C\C(O)(/C=C/c1c(C)cc(C)cc1C)C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C18H20F6O2/c1-5-26-15(17(19,20)21)10-16(25,18(22,23)24)7-6-14-12(3)8-11(2)9-13(14)4/h6-10,25H,5H2,1-4H3/b7-6+,15-10- |
| InChIKey | BSFCMZCNCYVMQL-ZWWGVYCGSA-N |
| XLogP | 5.40 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.34 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|