C16H26FN3 — CID 105239692
[1-(4-fluoro-2-methylphenyl)-3-methyl-3-pyrrolidin-1-ylbutan-2-yl]hydrazine (PubChem CID 105239692) has the molecular formula C16H26FN3 and a molecular weight of 279.40 g/mol. Its IUPAC name is [1-(4-fluoro-2-methylphenyl)-3-methyl-3-pyrrolidin-1-ylbutan-2-yl]hydrazine.
| Compound Name | [1-(4-fluoro-2-methylphenyl)-3-methyl-3-pyrrolidin-1-ylbutan-2-yl]hydrazine |
|---|---|
| PubChem CID | 105239692 |
| Molecular Formula | C16H26FN3 |
| Molecular Weight | 279.40 g/mol |
| Exact Mass | 279.21 |
| IUPAC Name | [1-(4-fluoro-2-methylphenyl)-3-methyl-3-pyrrolidin-1-ylbutan-2-yl]hydrazine |
| SMILES | Cc1cc(F)ccc1CC(NN)C(C)(C)N1CCCC1 |
| InChI | InChI=1S/C16H26FN3/c1-12-10-14(17)7-6-13(12)11-15(19-18)16(2,3)20-8-4-5-9-20/h6-7,10,15,19H,4-5,8-9,11,18H2,1-3H3 |
| InChIKey | KBTTZJUBCOELPS-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 41.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.40 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|