C13H23N3S — CID 105239795
(2-methyl-2-piperidin-1-yl-1-thiophen-3-ylpropyl)hydrazine (PubChem CID 105239795) has the molecular formula C13H23N3S and a molecular weight of 253.41 g/mol. Its IUPAC name is (2-methyl-2-piperidin-1-yl-1-thiophen-3-ylpropyl)hydrazine.
| Compound Name | (2-methyl-2-piperidin-1-yl-1-thiophen-3-ylpropyl)hydrazine |
|---|---|
| PubChem CID | 105239795 |
| Molecular Formula | C13H23N3S |
| Molecular Weight | 253.41 g/mol |
| Exact Mass | 253.16 |
| IUPAC Name | (2-methyl-2-piperidin-1-yl-1-thiophen-3-ylpropyl)hydrazine |
| SMILES | CC(C)(C(NN)c1ccsc1)N1CCCCC1 |
| InChI | InChI=1S/C13H23N3S/c1-13(2,16-7-4-3-5-8-16)12(15-14)11-6-9-17-10-11/h6,9-10,12,15H,3-5,7-8,14H2,1-2H3 |
| InChIKey | NCSYQDWPJGTSAN-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 41.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.41 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|