C21H38O4Si — CID 10523993
[(2R,4aR,8S,8aS)-8-[tert-butyl(dimethyl)silyl]oxy-6,6,8a-trimethyl-4-oxo-2,3,4a,5,7,8-hexahydro-1H-naphthalen-2-yl] acetate (PubChem CID 10523993) has the molecular formula C21H38O4Si and a molecular weight of 382.62 g/mol. Its IUPAC name is [(2R,4aR,8S,8aS)-8-[tert-butyl(dimethyl)silyl]oxy-6,6,8a-trimethyl-4-oxo-2,3,4a,5,7,8-hexahydro-1H-naphthalen-2-yl] acetate.
| Compound Name | [(2R,4aR,8S,8aS)-8-[tert-butyl(dimethyl)silyl]oxy-6,6,8a-trimethyl-4-oxo-2,3,4a,5,7,8-hexahydro-1H-naphthalen-2-yl] acetate |
|---|---|
| PubChem CID | 10523993 |
| Molecular Formula | C21H38O4Si |
| Molecular Weight | 382.62 g/mol |
| Exact Mass | 382.25 |
| IUPAC Name | [(2R,4aR,8S,8aS)-8-[tert-butyl(dimethyl)silyl]oxy-6,6,8a-trimethyl-4-oxo-2,3,4a,5,7,8-hexahydro-1H-naphthalen-2-yl] acetate |
| SMILES | CC(=O)O[C@H]1CC(=O)[C@@H]2CC(C)(C)C[C@H](O[Si](C)(C)C(C)(C)C)[C@@]2(C)C1 |
| InChI | InChI=1S/C21H38O4Si/c1-14(22)24-15-10-17(23)16-12-20(5,6)13-18(21(16,7)11-15)25-26(8,9)19(2,3)4/h15-16,18H,10-13H2,1-9H3/t15-,16-,18-,21-/m0/s1 |
| InChIKey | USPLGBCFAPCHSD-STHPQGGCSA-N |
| XLogP | 5.11 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.62 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|