C13H23N3OS — CID 105240145
[2-methyl-1-(3-methylthiophen-2-yl)-2-morpholin-4-ylpropyl]hydrazine (PubChem CID 105240145) has the molecular formula C13H23N3OS and a molecular weight of 269.41 g/mol. Its IUPAC name is [2-methyl-1-(3-methylthiophen-2-yl)-2-morpholin-4-ylpropyl]hydrazine.
| Compound Name | [2-methyl-1-(3-methylthiophen-2-yl)-2-morpholin-4-ylpropyl]hydrazine |
|---|---|
| PubChem CID | 105240145 |
| Molecular Formula | C13H23N3OS |
| Molecular Weight | 269.41 g/mol |
| Exact Mass | 269.16 |
| IUPAC Name | [2-methyl-1-(3-methylthiophen-2-yl)-2-morpholin-4-ylpropyl]hydrazine |
| SMILES | Cc1ccsc1C(NN)C(C)(C)N1CCOCC1 |
| InChI | InChI=1S/C13H23N3OS/c1-10-4-9-18-11(10)12(15-14)13(2,3)16-5-7-17-8-6-16/h4,9,12,15H,5-8,14H2,1-3H3 |
| InChIKey | ALZNOELILZSVGP-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 50.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.41 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|