About [2-(azepan-1-yl)-7,7,7-trifluoro-2-methylheptan-3-yl]hydrazine
[2-(azepan-1-yl)-7,7,7-trifluoro-2-methylheptan-3-yl]hydrazine (PubChem CID 105240313) has the molecular formula C14H28F3N3
and a molecular weight of 295.39 g/mol. Its IUPAC name is [2-(azepan-1-yl)-7,7,7-trifluoro-2-methylheptan-3-yl]hydrazine.
Molecular Properties
| Compound Name | [2-(azepan-1-yl)-7,7,7-trifluoro-2-methylheptan-3-yl]hydrazine |
| PubChem CID | 105240313 |
| Molecular Formula | C14H28F3N3 |
| Molecular Weight | 295.39 g/mol |
| Exact Mass | 295.22 |
| IUPAC Name | [2-(azepan-1-yl)-7,7,7-trifluoro-2-methylheptan-3-yl]hydrazine |
| SMILES | CC(C)(C(CCCC(F)(F)F)NN)N1CCCCCC1 |
| InChI | InChI=1S/C14H28F3N3/c1-13(2,20-10-5-3-4-6-11-20)12(19-18)8-7-9-14(15,16)17/h12,19H,3-11,18H2,1-2H3 |
| InChIKey | OHWUMYCSJZSFPT-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 41.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 295.39 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze [2-(azepan-1-yl)-7,7,7-trifluoro-2-methylheptan-3-yl]hydrazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-(azepan-1-yl)-7,7,7-trifluoro-2-methylheptan-3-yl]hydrazine?
The IUPAC name of [2-(azepan-1-yl)-7,7,7-trifluoro-2-methylheptan-3-yl]hydrazine (CID 105240313) is [2-(azepan-1-yl)-7,7,7-trifluoro-2-methylheptan-3-yl]hydrazine.
What is the SMILES notation for [2-(azepan-1-yl)-7,7,7-trifluoro-2-methylheptan-3-yl]hydrazine?
The canonical SMILES for [2-(azepan-1-yl)-7,7,7-trifluoro-2-methylheptan-3-yl]hydrazine is CC(C)(C(CCCC(F)(F)F)NN)N1CCCCCC1.
What is the InChIKey of [2-(azepan-1-yl)-7,7,7-trifluoro-2-methylheptan-3-yl]hydrazine?
The InChIKey is OHWUMYCSJZSFPT-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H28F3N3/c1-13(2,20-10-5-3-4-6-11-20)12(19-18)8-7-9-14(15,16)17/h12,19H,3-11,18H2,1-2H3.
What are the key properties of [2-(azepan-1-yl)-7,7,7-trifluoro-2-methylheptan-3-yl]hydrazine?
[2-(azepan-1-yl)-7,7,7-trifluoro-2-methylheptan-3-yl]hydrazine has a molecular weight of 295.39 g/mol, XLogP of 3.21, 6 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [2-(azepan-1-yl)-7,7,7-trifluoro-2-methylheptan-3-yl]hydrazine is sourced from PubChem (CID 105240313), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).